C26H22O5 — CID 177446641
methyl (1S,3S,3aS,6S,6aR)-4-oxo-1,3,6-triphenyl-1,3,6,6a-tetrahydrofuro[3,4-c]furan-3a-carboxylate (PubChem CID 177446641) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl (1S,3S,3aS,6S,6aR)-4-oxo-1,3,6-triphenyl-1,3,6,6a-tetrahydrofuro[3,4-c]furan-3a-carboxylate.
| Compound Name | methyl (1S,3S,3aS,6S,6aR)-4-oxo-1,3,6-triphenyl-1,3,6,6a-tetrahydrofuro[3,4-c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 177446641 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | methyl (1S,3S,3aS,6S,6aR)-4-oxo-1,3,6-triphenyl-1,3,6,6a-tetrahydrofuro[3,4-c]furan-3a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)O[C@H](c3ccccc3)[C@H]1[C@@H](c1ccccc1)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H22O5/c1-29-24(27)26-20(22(31-25(26)28)18-13-7-3-8-14-18)21(17-11-5-2-6-12-17)30-23(26)19-15-9-4-10-16-19/h2-16,20-23H,1H3/t20-,21-,22-,23+,26+/m1/s1 |
| InChIKey | OGBDQEPCBGTVNT-HQRDVSCTSA-N |
| XLogP | 4.57 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|