C24H23NO — CID 177449196
(4Z)-2-methyl-4-[(1S,2R,10S,11R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienylidene]-3H-isoquinolin-1-one (PubChem CID 177449196) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is (4Z)-2-methyl-4-[(1S,2R,10S,11R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienylidene]-3H-isoquinolin-1-one.
| Compound Name | (4Z)-2-methyl-4-[(1S,2R,10S,11R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienylidene]-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 177449196 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (4Z)-2-methyl-4-[(1S,2R,10S,11R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienylidene]-3H-isoquinolin-1-one |
| SMILES | CN1C/C(=C2\c3ccccc3[C@@H]3[C@H]4CC[C@H](C4)[C@H]23)c2ccccc2C1=O |
| InChI | InChI=1S/C24H23NO/c1-25-13-20(16-6-2-5-9-19(16)24(25)26)23-18-8-4-3-7-17(18)21-14-10-11-15(12-14)22(21)23/h2-9,14-15,21-22H,10-13H2,1H3/b23-20-/t14-,15+,21-,22-/m0/s1 |
| InChIKey | BHVZETUPSWCMFA-XBEHLUANSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|