C15H11NOSe — CID 177452416
1,3-benzoselenazol-2-yl-(4-methylphenyl)methanone (PubChem CID 177452416) has the molecular formula C15H11NOSe and a molecular weight of 300.22 g/mol. Its IUPAC name is 1,3-benzoselenazol-2-yl-(4-methylphenyl)methanone.
| Compound Name | 1,3-benzoselenazol-2-yl-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 177452416 |
| Molecular Formula | C15H11NOSe |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1,3-benzoselenazol-2-yl-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2nc3ccccc3[se]2)cc1 |
| InChI | InChI=1S/C15H11NOSe/c1-10-6-8-11(9-7-10)14(17)15-16-12-4-2-3-5-13(12)18-15/h2-9H,1H3 |
| InChIKey | SMGVZYSWBAHXLM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|