C12H17NO3 — CID 177452578
ethyl (1S,4E,5R)-4-ethylidene-7-oxo-2-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 177452578) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is ethyl (1S,4E,5R)-4-ethylidene-7-oxo-2-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | ethyl (1S,4E,5R)-4-ethylidene-7-oxo-2-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 177452578 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | ethyl (1S,4E,5R)-4-ethylidene-7-oxo-2-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C/C=C1/CN(C(=O)OCC)[C@H]2C[C@@H]1CC2=O |
| InChI | InChI=1S/C12H17NO3/c1-3-8-7-13(12(15)16-4-2)10-5-9(8)6-11(10)14/h3,9-10H,4-7H2,1-2H3/b8-3-/t9-,10+/m1/s1 |
| InChIKey | AQUZWXINCOBZHW-IVIAJXKQSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|