C33H33N5O3 — CID 177456037
6-[(2,4-dimethoxyphenyl)methylimino]-1-hydroxy-4-N-(3-phenylphenyl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,4-diamine (PubChem CID 177456037) has the molecular formula C33H33N5O3 and a molecular weight of 547.66 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyphenyl)methylimino]-1-hydroxy-4-N-(3-phenylphenyl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,4-diamine.
| Compound Name | 6-[(2,4-dimethoxyphenyl)methylimino]-1-hydroxy-4-N-(3-phenylphenyl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 177456037 |
| Molecular Formula | C33H33N5O3 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 6-[(2,4-dimethoxyphenyl)methylimino]-1-hydroxy-4-N-(3-phenylphenyl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,4-diamine |
| SMILES | COc1ccc(C/N=c2\cc(Nc3cccc(-c4ccccc4)c3)cc(NCCc3ccccn3)n2O)c(OC)c1 |
| InChI | InChI=1S/C33H33N5O3/c1-40-30-15-14-26(31(22-30)41-2)23-36-33-21-29(20-32(38(33)39)35-18-16-27-12-6-7-17-34-27)37-28-13-8-11-25(19-28)24-9-4-3-5-10-24/h3-15,17,19-22,35,37,39H,16,18,23H2,1-2H3/b36-33+ |
| InChIKey | IYKSOUHWFAVZBL-PKUSAGTQSA-N |
| XLogP | 6.30 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|