C26H36O5 — CID 177459685
(1S,4S,5R,6R,7R)-5-hydroxy-7-[(1E,3E,5E,7E)-8-[(2S,5R,6S)-5-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 177459685) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is (1S,4S,5R,6R,7R)-5-hydroxy-7-[(1E,3E,5E,7E)-8-[(2S,5R,6S)-5-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4S,5R,6R,7R)-5-hydroxy-7-[(1E,3E,5E,7E)-8-[(2S,5R,6S)-5-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 177459685 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (1S,4S,5R,6R,7R)-5-hydroxy-7-[(1E,3E,5E,7E)-8-[(2S,5R,6S)-5-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | CC1=C[C@@](C)(O)[C@H](C)O[C@H]1/C(C)=C/C=C/C=C/C=C/[C@@]1(C)[C@H]2OC(=O)[C@]1(C)[C@H](O)[C@H]2C |
| InChI | InChI=1S/C26H36O5/c1-16(20-17(2)15-25(6,29)19(4)30-20)13-11-9-8-10-12-14-24(5)22-18(3)21(27)26(24,7)23(28)31-22/h8-15,18-22,27,29H,1-7H3/b10-8+,11-9+,14-12+,16-13+/t18-,19+,20+,21-,22+,24+,25-,26+/m1/s1 |
| InChIKey | CDMDAJJBCCPFDT-DEHHGBTBSA-N |
| XLogP | 4.03 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|