C26H34O5 — CID 163064230
7-[8-(3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl)nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 163064230) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 7-[8-(3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl)nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | 7-[8-(3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl)nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 163064230 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 7-[8-(3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl)nona-1,3,5,7-tetraenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | CC1=CC(C)(O)C(C(C)=CC=CC=CC=CC2(C)C3OC(=O)C2(C)C(=O)C3C)OC1C |
| InChI | InChI=1S/C26H34O5/c1-16(21-25(6,29)15-17(2)19(4)30-21)13-11-9-8-10-12-14-24(5)22-18(3)20(27)26(24,7)23(28)31-22/h8-15,18-19,21-22,29H,1-7H3 |
| InChIKey | KSCZOENBBUGNJI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|