C20H25NO3 — CID 177460214
4-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]-1-methylquinolin-2-one (PubChem CID 177460214) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]-1-methylquinolin-2-one.
| Compound Name | 4-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 177460214 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]-1-methylquinolin-2-one |
| SMILES | C/C(=C\COc1cc(=O)n(C)c2ccccc12)C/C=C/C(C)(C)O |
| InChI | InChI=1S/C20H25NO3/c1-15(8-7-12-20(2,3)23)11-13-24-18-14-19(22)21(4)17-10-6-5-9-16(17)18/h5-7,9-12,14,23H,8,13H2,1-4H3/b12-7+,15-11+ |
| InChIKey | UACOTRYHNWCXII-BQNYFXIZSA-N |
| XLogP | 3.58 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|