C21H36O6Si — CID 177462555
diethyl (1S,2R,3R)-3-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 177462555) has the molecular formula C21H36O6Si and a molecular weight of 412.60 g/mol. Its IUPAC name is diethyl (1S,2R,3R)-3-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl (1S,2R,3R)-3-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177462555 |
| Molecular Formula | C21H36O6Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | diethyl (1S,2R,3R)-3-[(E)-1-[tert-butyl(dimethyl)silyl]oxyprop-1-enoxy]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C/C=C(\O[C@@H]1C=CC[C@H](C(=O)OCC)[C@H]1C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O6Si/c1-9-17(27-28(7,8)21(4,5)6)26-16-14-12-13-15(19(22)24-10-2)18(16)20(23)25-11-3/h9,12,14-16,18H,10-11,13H2,1-8H3/b17-9+/t15-,16+,18+/m0/s1 |
| InChIKey | VIYAHODVBIUDAR-SXWVOLIRSA-N |
| XLogP | 4.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|