C30H39NO4 — CID 177462658
[(1S,2R,3E,5R,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate (PubChem CID 177462658) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is [(1S,2R,3E,5R,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate.
| Compound Name | [(1S,2R,3E,5R,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate |
|---|---|
| PubChem CID | 177462658 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | [(1S,2R,3E,5R,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/[C@](C)(O)CC(C)C/C=C/[C@H]2C=C(C)[C@@H](C)[C@H]3[C@H](Cc4ccccc4)NC(=O)[C@]321 |
| InChI | InChI=1S/C30H39NO4/c1-19-10-9-13-24-16-20(2)21(3)27-25(17-23-11-7-6-8-12-23)31-28(33)30(24,27)26(35-22(4)32)14-15-29(5,34)18-19/h6-9,11-16,19,21,24-27,34H,10,17-18H2,1-5H3,(H,31,33)/b13-9+,15-14+/t19?,21-,24+,25+,26-,27+,29+,30-/m1/s1 |
| InChIKey | LYHWACCLUSDGME-VEAIYUNGSA-N |
| XLogP | 4.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|