C14H11LiO — CID 177463264
lithium (2S,3S)-3-phenyl-2-phenyloxirane (PubChem CID 177463264) has the molecular formula C14H11LiO and a molecular weight of 202.18 g/mol. Its IUPAC name is lithium (2S,3S)-3-phenyl-2-phenyloxirane.
| Compound Name | lithium (2S,3S)-3-phenyl-2-phenyloxirane |
|---|---|
| PubChem CID | 177463264 |
| Molecular Formula | C14H11LiO |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | lithium (2S,3S)-3-phenyl-2-phenyloxirane |
| SMILES | [Li+].[c-]1ccccc1[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H11O.Li/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12;/h1-9,13-14H;/q-1;+1/t13-,14-;/m0./s1 |
| InChIKey | CIANSFBBBJDXOG-IODNYQNNSA-N |
| XLogP | 0.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|