C31H49N2O3Si4+ — CID 177464933
N,N-dimethyl-4-[(E)-2-[1-[[4-tris(trimethylsilyloxy)silylphenyl]methyl]pyridin-1-ium-4-yl]ethenyl]aniline (PubChem CID 177464933) has the molecular formula C31H49N2O3Si4+ and a molecular weight of 610.09 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[1-[[4-tris(trimethylsilyloxy)silylphenyl]methyl]pyridin-1-ium-4-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[1-[[4-tris(trimethylsilyloxy)silylphenyl]methyl]pyridin-1-ium-4-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 177464933 |
| Molecular Formula | C31H49N2O3Si4+ |
| Molecular Weight | 610.09 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[1-[[4-tris(trimethylsilyloxy)silylphenyl]methyl]pyridin-1-ium-4-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](Cc3ccc([Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H49N2O3Si4/c1-32(2)30-18-14-27(15-19-30)12-13-28-22-24-33(25-23-28)26-29-16-20-31(21-17-29)40(34-37(3,4)5,35-38(6,7)8)36-39(9,10)11/h12-25H,26H2,1-11H3/q+1 |
| InChIKey | ZEYRXCSESLEJCY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 34.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.09 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|