C36H41NO4Si — CID 59348829
4-[(E)-2-[4-[(E)-2-[3,5-dimethyl-4-[(4-trimethoxysilylphenyl)methoxy]phenyl]ethenyl]phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 59348829) has the molecular formula C36H41NO4Si and a molecular weight of 579.81 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-[3,5-dimethyl-4-[(4-trimethoxysilylphenyl)methoxy]phenyl]ethenyl]phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-[(E)-2-[3,5-dimethyl-4-[(4-trimethoxysilylphenyl)methoxy]phenyl]ethenyl]phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59348829 |
| Molecular Formula | C36H41NO4Si |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-[3,5-dimethyl-4-[(4-trimethoxysilylphenyl)methoxy]phenyl]ethenyl]phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CO[Si](OC)(OC)c1ccc(COc2c(C)cc(/C=C/c3ccc(/C=C/c4ccc(N(C)C)cc4)cc3)cc2C)cc1 |
| InChI | InChI=1S/C36H41NO4Si/c1-27-24-33(15-14-30-10-8-29(9-11-30)12-13-31-16-20-34(21-17-31)37(3)4)25-28(2)36(27)41-26-32-18-22-35(23-19-32)42(38-5,39-6)40-7/h8-25H,26H2,1-7H3/b13-12+,15-14+ |
| InChIKey | VPFKCNUXTCLWEC-SQIWNDBBSA-N |
| XLogP | 7.37 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|