C33H35NO3Si — CID 59348807
1-[4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]phenyl]-N-[(4-trimethoxysilylphenyl)methyl]methanamine (PubChem CID 59348807) has the molecular formula C33H35NO3Si and a molecular weight of 521.73 g/mol. Its IUPAC name is 1-[4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]phenyl]-N-[(4-trimethoxysilylphenyl)methyl]methanamine.
| Compound Name | 1-[4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]phenyl]-N-[(4-trimethoxysilylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 59348807 |
| Molecular Formula | C33H35NO3Si |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 1-[4-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]phenyl]-N-[(4-trimethoxysilylphenyl)methyl]methanamine |
| SMILES | CO[Si](OC)(OC)c1ccc(CNCc2ccc(/C=C/c3ccc(/C=C/c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H35NO3Si/c1-35-38(36-2,37-3)33-23-21-32(22-24-33)26-34-25-31-19-17-30(18-20-31)16-15-29-13-11-28(12-14-29)10-9-27-7-5-4-6-8-27/h4-24,34H,25-26H2,1-3H3/b10-9+,16-15+ |
| InChIKey | YUTPOSJCKOYPCT-DSIBUQCCSA-N |
| XLogP | 6.40 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|