C17H16OS — CID 177465331
5-methyl-4-[(Z)-2-sulfanylprop-1-enyl]-2,3-dihydrocyclopenta[a]naphthalen-1-one (PubChem CID 177465331) has the molecular formula C17H16OS and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-methyl-4-[(Z)-2-sulfanylprop-1-enyl]-2,3-dihydrocyclopenta[a]naphthalen-1-one.
| Compound Name | 5-methyl-4-[(Z)-2-sulfanylprop-1-enyl]-2,3-dihydrocyclopenta[a]naphthalen-1-one |
|---|---|
| PubChem CID | 177465331 |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-methyl-4-[(Z)-2-sulfanylprop-1-enyl]-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| SMILES | C/C(S)=C/c1c2c(c3ccccc3c1C)C(=O)CC2 |
| InChI | InChI=1S/C17H16OS/c1-10(19)9-15-11(2)12-5-3-4-6-13(12)17-14(15)7-8-16(17)18/h3-6,9,19H,7-8H2,1-2H3/b10-9- |
| InChIKey | ZFJPWCIRNRDRFC-KTKRTIGZSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|