C23H33N5O3 — CID 177469236
(3aR,4R,7S,7aS)-4-(1-cyclohexyltetrazol-5-yl)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 177469236) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-4-(1-cyclohexyltetrazol-5-yl)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aR,4R,7S,7aS)-4-(1-cyclohexyltetrazol-5-yl)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 177469236 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (3aR,4R,7S,7aS)-4-(1-cyclohexyltetrazol-5-yl)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | C[C@@H](c1ccccc1)N1C[C@H](O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1c1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C23H33N5O3/c1-15(16-10-6-4-7-11-16)27-14-18(29)20-21(31-23(2,3)30-20)19(27)22-24-25-26-28(22)17-12-8-5-9-13-17/h4,6-7,10-11,15,17-21,29H,5,8-9,12-14H2,1-3H3/t15-,18-,19-,20-,21+/m0/s1 |
| InChIKey | WOVVQFASQOTSNQ-DXUGQKIESA-N |
| XLogP | 3.18 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |