C17H34N2O — CID 177471787
(1Z,1R,2S,5R)-5-methyl-2-propan-2-yl-N-(triethylazaniumyl)cyclohexane-1-carboximidate (PubChem CID 177471787) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is (1Z,1R,2S,5R)-5-methyl-2-propan-2-yl-N-(triethylazaniumyl)cyclohexane-1-carboximidate.
| Compound Name | (1Z,1R,2S,5R)-5-methyl-2-propan-2-yl-N-(triethylazaniumyl)cyclohexane-1-carboximidate |
|---|---|
| PubChem CID | 177471787 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | (1Z,1R,2S,5R)-5-methyl-2-propan-2-yl-N-(triethylazaniumyl)cyclohexane-1-carboximidate |
| SMILES | CC[N+](CC)(CC)/N=C(\[O-])[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C17H34N2O/c1-7-19(8-2,9-3)18-17(20)16-12-14(6)10-11-15(16)13(4)5/h13-16H,7-12H2,1-6H3/t14-,15+,16-/m1/s1 |
| InChIKey | FFDHOTFHONGDQP-OWCLPIDISA-N |
| XLogP | 3.25 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|