C39H55N3O4 — CID 177472092
5-decoxy-2-[[2-[(E)-(4-decoxy-2-hydroxyphenyl)methylideneamino]-3-pyridinyl]iminomethyl]phenol (PubChem CID 177472092) has the molecular formula C39H55N3O4 and a molecular weight of 629.89 g/mol. Its IUPAC name is 5-decoxy-2-[[2-[(E)-(4-decoxy-2-hydroxyphenyl)methylideneamino]-3-pyridinyl]iminomethyl]phenol.
| Compound Name | 5-decoxy-2-[[2-[(E)-(4-decoxy-2-hydroxyphenyl)methylideneamino]-3-pyridinyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 177472092 |
| Molecular Formula | C39H55N3O4 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.42 |
| IUPAC Name | 5-decoxy-2-[[2-[(E)-(4-decoxy-2-hydroxyphenyl)methylideneamino]-3-pyridinyl]iminomethyl]phenol |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2cccnc2/N=C/c2ccc(OCCCCCCCCCC)cc2O)c(O)c1 |
| InChI | InChI=1S/C39H55N3O4/c1-3-5-7-9-11-13-15-17-26-45-34-23-21-32(37(43)28-34)30-41-36-20-19-25-40-39(36)42-31-33-22-24-35(29-38(33)44)46-27-18-16-14-12-10-8-6-4-2/h19-25,28-31,43-44H,3-18,26-27H2,1-2H3/b41-30+,42-31+ |
| InChIKey | ALYRUGHHVNDQOF-ZTJVYISYSA-N |
| XLogP | 11.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|