C26H24N2O9 — CID 177480648
[(2S,8S)-6-acetyl-17-acetyloxy-16-methyl-4,7-dioxo-12,14-dioxa-3,6-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),10,15-trien-2-yl]methyl benzoate (PubChem CID 177480648) has the molecular formula C26H24N2O9 and a molecular weight of 508.48 g/mol. Its IUPAC name is [(2S,8S)-6-acetyl-17-acetyloxy-16-methyl-4,7-dioxo-12,14-dioxa-3,6-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),10,15-trien-2-yl]methyl benzoate.
| Compound Name | [(2S,8S)-6-acetyl-17-acetyloxy-16-methyl-4,7-dioxo-12,14-dioxa-3,6-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),10,15-trien-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 177480648 |
| Molecular Formula | C26H24N2O9 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | [(2S,8S)-6-acetyl-17-acetyloxy-16-methyl-4,7-dioxo-12,14-dioxa-3,6-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),10,15-trien-2-yl]methyl benzoate |
| SMILES | CC(=O)Oc1c(C)c2c(c3c1[C@@H](COC(=O)c1ccccc1)N1C(=O)CN(C(C)=O)C(=O)[C@@H]1C3)OCO2 |
| InChI | InChI=1S/C26H24N2O9/c1-13-22(37-15(3)30)21-17(24-23(13)35-12-36-24)9-18-25(32)27(14(2)29)10-20(31)28(18)19(21)11-34-26(33)16-7-5-4-6-8-16/h4-8,18-19H,9-12H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | SUPOSZYDTUVZHZ-RBUKOAKNSA-N |
| XLogP | 1.69 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|