C20H16O6 — CID 71439554
(5-benzoyloxy-4-oxo-2,3-dihydropyran-2-yl)methyl benzoate (PubChem CID 71439554) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is (5-benzoyloxy-4-oxo-2,3-dihydropyran-2-yl)methyl benzoate.
| Compound Name | (5-benzoyloxy-4-oxo-2,3-dihydropyran-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 71439554 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (5-benzoyloxy-4-oxo-2,3-dihydropyran-2-yl)methyl benzoate |
| SMILES | O=C1CC(COC(=O)c2ccccc2)OC=C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16O6/c21-17-11-16(12-25-19(22)14-7-3-1-4-8-14)24-13-18(17)26-20(23)15-9-5-2-6-10-15/h1-10,13,16H,11-12H2 |
| InChIKey | NPIJOFXVSZQPEB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |