C17H32O2Si — CID 177481769
2-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3-methylcyclopentan-1-one (PubChem CID 177481769) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is 2-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3-methylcyclopentan-1-one.
| Compound Name | 2-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 177481769 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 2-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3-methylcyclopentan-1-one |
| SMILES | CC1CCC(=O)C1/C=C\CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-14-11-12-16(18)15(14)10-8-7-9-13-19-20(5,6)17(2,3)4/h8,10,14-15H,7,9,11-13H2,1-6H3/b10-8- |
| InChIKey | GNHLPYABTLMWFY-NTMALXAHSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|