C33H37N2Si2- — CID 177483543
[(E,3Z)-1,3-bis(4-phenylphenyl)-3-trimethylsilyliminoprop-1-enyl]-trimethylsilylazanide (PubChem CID 177483543) has the molecular formula C33H37N2Si2- and a molecular weight of 517.85 g/mol. Its IUPAC name is [(E,3Z)-1,3-bis(4-phenylphenyl)-3-trimethylsilyliminoprop-1-enyl]-trimethylsilylazanide.
| Compound Name | [(E,3Z)-1,3-bis(4-phenylphenyl)-3-trimethylsilyliminoprop-1-enyl]-trimethylsilylazanide |
|---|---|
| PubChem CID | 177483543 |
| Molecular Formula | C33H37N2Si2- |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | [(E,3Z)-1,3-bis(4-phenylphenyl)-3-trimethylsilyliminoprop-1-enyl]-trimethylsilylazanide |
| SMILES | C[Si](C)(C)/N=C(/C=C(/[N-][Si](C)(C)C)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H37N2Si2/c1-36(2,3)34-32(30-21-17-28(18-22-30)26-13-9-7-10-14-26)25-33(35-37(4,5)6)31-23-19-29(20-24-31)27-15-11-8-12-16-27/h7-25H,1-6H3/q-1/b32-25+,35-33- |
| InChIKey | JBSPHGIIPHDWOK-HLRLCTMVSA-N |
| XLogP | 9.89 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|