bis(1,1'-biphenyl);phosphonous acid

C24H23O2P — CID 175129558

IUPACbis(1,1'-biphenyl);phosphonous acid
SMILESOPO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/2C12H10.H3O2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;1-3H
InChIKeyWIEJVVRKEYPMLJ-UHFFFAOYSA-N
MW374.42 g/mol
LogP6.19
Rot. Bonds2

About bis(1,1'-biphenyl);phosphonous acid

bis(1,1'-biphenyl);phosphonous acid (PubChem CID 175129558) has the molecular formula C24H23O2P and a molecular weight of 374.42 g/mol. Its IUPAC name is bis(1,1'-biphenyl);phosphonous acid.

Molecular Properties

Compound Namebis(1,1'-biphenyl);phosphonous acid
PubChem CID175129558
Molecular FormulaC24H23O2P
Molecular Weight374.42 g/mol
Exact Mass374.14
IUPAC Namebis(1,1'-biphenyl);phosphonous acid
SMILESOPO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/2C12H10.H3O2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;1-3H
InChIKeyWIEJVVRKEYPMLJ-UHFFFAOYSA-N
XLogP6.19
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.42
LogP ≤ 56.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(1,1'-biphenyl);phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(1,1'-biphenyl);phosphonous acid?
The IUPAC name of bis(1,1'-biphenyl);phosphonous acid (CID 175129558) is bis(1,1'-biphenyl);phosphonous acid.
What is the SMILES notation for bis(1,1'-biphenyl);phosphonous acid?
The canonical SMILES for bis(1,1'-biphenyl);phosphonous acid is OPO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(1,1'-biphenyl);phosphonous acid?
The InChIKey is WIEJVVRKEYPMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10.H3O2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;1-3H.
What are the key properties of bis(1,1'-biphenyl);phosphonous acid?
bis(1,1'-biphenyl);phosphonous acid has a molecular weight of 374.42 g/mol, XLogP of 6.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1'-biphenyl);phosphonous acid is sourced from PubChem (CID 175129558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).