About bis(1,1'-biphenyl);phosphonous acid
bis(1,1'-biphenyl);phosphonous acid (PubChem CID 175129558) has the molecular formula C24H23O2P
and a molecular weight of 374.42 g/mol. Its IUPAC name is bis(1,1'-biphenyl);phosphonous acid.
Molecular Properties
| Compound Name | bis(1,1'-biphenyl);phosphonous acid |
| PubChem CID | 175129558 |
| Molecular Formula | C24H23O2P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | bis(1,1'-biphenyl);phosphonous acid |
| SMILES | OPO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H10.H3O2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;1-3H |
| InChIKey | WIEJVVRKEYPMLJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1,1'-biphenyl);phosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,1'-biphenyl);phosphonous acid?
The IUPAC name of bis(1,1'-biphenyl);phosphonous acid (CID 175129558) is bis(1,1'-biphenyl);phosphonous acid.
What is the SMILES notation for bis(1,1'-biphenyl);phosphonous acid?
The canonical SMILES for bis(1,1'-biphenyl);phosphonous acid is OPO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(1,1'-biphenyl);phosphonous acid?
The InChIKey is WIEJVVRKEYPMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10.H3O2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;1-3H.
What are the key properties of bis(1,1'-biphenyl);phosphonous acid?
bis(1,1'-biphenyl);phosphonous acid has a molecular weight of 374.42 g/mol, XLogP of 6.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1'-biphenyl);phosphonous acid is sourced from PubChem (CID 175129558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).