C37H44N2O6S2 — CID 177483935
4-[4-[9,9-dipropyl-7-[1-(4-sulfonatobutyl)pyridin-1-ium-4-yl]fluoren-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 177483935) has the molecular formula C37H44N2O6S2 and a molecular weight of 676.90 g/mol. Its IUPAC name is 4-[4-[9,9-dipropyl-7-[1-(4-sulfonatobutyl)pyridin-1-ium-4-yl]fluoren-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[4-[9,9-dipropyl-7-[1-(4-sulfonatobutyl)pyridin-1-ium-4-yl]fluoren-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 177483935 |
| Molecular Formula | C37H44N2O6S2 |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 4-[4-[9,9-dipropyl-7-[1-(4-sulfonatobutyl)pyridin-1-ium-4-yl]fluoren-2-yl]pyridin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CCCC1(CCC)c2cc(-c3cc[n+](CCCCS(=O)(=O)[O-])cc3)ccc2-c2ccc(-c3cc[n+](CCCCS(=O)(=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C37H44N2O6S2/c1-3-17-37(18-4-2)35-27-31(29-13-21-38(22-14-29)19-5-7-25-46(40,41)42)9-11-33(35)34-12-10-32(28-36(34)37)30-15-23-39(24-16-30)20-6-8-26-47(43,44)45/h9-16,21-24,27-28H,3-8,17-20,25-26H2,1-2H3 |
| InChIKey | BEIFTZBJRCAGLI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|