C27H30O6Se — CID 177485352
[(2S)-2-[(2S,3aS,4R,6S,7aS)-2-methoxy-3a-phenylmethoxy-6-phenylselanyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-4-yl]but-3-yn-2-yl] acetate (PubChem CID 177485352) has the molecular formula C27H30O6Se and a molecular weight of 529.49 g/mol. Its IUPAC name is [(2S)-2-[(2S,3aS,4R,6S,7aS)-2-methoxy-3a-phenylmethoxy-6-phenylselanyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-4-yl]but-3-yn-2-yl] acetate.
| Compound Name | [(2S)-2-[(2S,3aS,4R,6S,7aS)-2-methoxy-3a-phenylmethoxy-6-phenylselanyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-4-yl]but-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 177485352 |
| Molecular Formula | C27H30O6Se |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | [(2S)-2-[(2S,3aS,4R,6S,7aS)-2-methoxy-3a-phenylmethoxy-6-phenylselanyl-2,3,4,5,6,7a-hexahydrofuro[2,3-b]pyran-4-yl]but-3-yn-2-yl] acetate |
| SMILES | C#C[C@@](C)(OC(C)=O)[C@H]1C[C@H]([Se]c2ccccc2)O[C@@H]2O[C@H](OC)C[C@@]21OCc1ccccc1 |
| InChI | InChI=1S/C27H30O6Se/c1-5-26(3,33-19(2)28)22-16-24(34-21-14-10-7-11-15-21)32-25-27(22,17-23(29-4)31-25)30-18-20-12-8-6-9-13-20/h1,6-15,22-25H,16-18H2,2-4H3/t22-,23+,24+,25+,26-,27+/m1/s1 |
| InChIKey | IDPPCBLMDOUNLW-GUWNOZFNSA-N |
| XLogP | 3.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|