C20H27BO4 — CID 177488271
phenyl (2Z,5Z)-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,5-dienoate (PubChem CID 177488271) has the molecular formula C20H27BO4 and a molecular weight of 342.24 g/mol. Its IUPAC name is phenyl (2Z,5Z)-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,5-dienoate.
| Compound Name | phenyl (2Z,5Z)-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,5-dienoate |
|---|---|
| PubChem CID | 177488271 |
| Molecular Formula | C20H27BO4 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | phenyl (2Z,5Z)-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hepta-2,5-dienoate |
| SMILES | CC(/C=C\CB1OC(C)(C)C(C)(C)O1)/C=C\C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H27BO4/c1-16(13-14-18(22)23-17-11-7-6-8-12-17)10-9-15-21-24-19(2,3)20(4,5)25-21/h6-14,16H,15H2,1-5H3/b10-9-,14-13- |
| InChIKey | PLTIMLOHIKHUCZ-KWUOUXIESA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|