C30H37BrO5 — CID 177489681
(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 177489681) has the molecular formula C30H37BrO5 and a molecular weight of 557.53 g/mol. Its IUPAC name is (6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | (6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 177489681 |
| Molecular Formula | C30H37BrO5 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCc1cc(=O)oc2cc(O)c(Br)cc12 |
| InChI | InChI=1S/C30H37BrO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-29(33)35-23-24-20-30(34)36-28-22-27(32)26(31)21-25(24)28/h6-7,9-10,12-13,15-16,20-22,32H,2-5,8,11,14,17-19,23H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | CNCFLCNJJGEGNT-DOFZRALJSA-N |
| XLogP | 8.45 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|