C13H21NO2 — CID 177492120
4-[1-(2-methylpropylamino)propyl]benzene-1,3-diol (PubChem CID 177492120) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-[1-(2-methylpropylamino)propyl]benzene-1,3-diol.
| Compound Name | 4-[1-(2-methylpropylamino)propyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 177492120 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-[1-(2-methylpropylamino)propyl]benzene-1,3-diol |
| SMILES | CCC(NCC(C)C)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H21NO2/c1-4-12(14-8-9(2)3)11-6-5-10(15)7-13(11)16/h5-7,9,12,14-16H,4,8H2,1-3H3 |
| InChIKey | NJHXRHGFCPFYAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|