C21H33NO4 — CID 177492304
tert-butyl (2S,4aS,5S,8aR)-5-ethenyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 177492304) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl (2S,4aS,5S,8aR)-5-ethenyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2S,4aS,5S,8aR)-5-ethenyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 177492304 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | tert-butyl (2S,4aS,5S,8aR)-5-ethenyl-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | C=C[C@@H]1CCC[C@@H]2[C@H]1CC[C@@H](/C=C/C(=O)OCC)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO4/c1-6-15-9-8-10-18-17(15)13-11-16(12-14-19(23)25-7-2)22(18)20(24)26-21(3,4)5/h6,12,14-18H,1,7-11,13H2,2-5H3/b14-12+/t15-,16+,17+,18-/m1/s1 |
| InChIKey | UVQBEHUDLHMQTQ-XRHPXHNASA-N |
| XLogP | 4.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|