C24H28N4O2 — CID 177495412
(NE)-N-[1-[3-[[(2E)-2-hydroxyimino-1-phenylpropylidene]amino]cyclohexyl]imino-1-phenylpropan-2-ylidene]hydroxylamine (PubChem CID 177495412) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (NE)-N-[1-[3-[[(2E)-2-hydroxyimino-1-phenylpropylidene]amino]cyclohexyl]imino-1-phenylpropan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[3-[[(2E)-2-hydroxyimino-1-phenylpropylidene]amino]cyclohexyl]imino-1-phenylpropan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 177495412 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (NE)-N-[1-[3-[[(2E)-2-hydroxyimino-1-phenylpropylidene]amino]cyclohexyl]imino-1-phenylpropan-2-ylidene]hydroxylamine |
| SMILES | CC(=N\O)/C(=N\C1CCCC(/N=C(C(\C)=N\O)/c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O2/c1-17(27-29)23(19-10-5-3-6-11-19)25-21-14-9-15-22(16-21)26-24(18(2)28-30)20-12-7-4-8-13-20/h3-8,10-13,21-22,29-30H,9,14-16H2,1-2H3/b25-23+,26-24+,27-17+,28-18+ |
| InChIKey | UUMUSQLKPBAWLL-UBWGOZJYSA-N |
| XLogP | 4.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|