C18H30N2O5S2 — CID 177498629
(1R,14R)-5-hydroxy-11-propyl-12-oxa-16,17-dithia-2,20-diazabicyclo[12.4.2]icosane-3,13,19-trione (PubChem CID 177498629) has the molecular formula C18H30N2O5S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (1R,14R)-5-hydroxy-11-propyl-12-oxa-16,17-dithia-2,20-diazabicyclo[12.4.2]icosane-3,13,19-trione.
| Compound Name | (1R,14R)-5-hydroxy-11-propyl-12-oxa-16,17-dithia-2,20-diazabicyclo[12.4.2]icosane-3,13,19-trione |
|---|---|
| PubChem CID | 177498629 |
| Molecular Formula | C18H30N2O5S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (1R,14R)-5-hydroxy-11-propyl-12-oxa-16,17-dithia-2,20-diazabicyclo[12.4.2]icosane-3,13,19-trione |
| SMILES | CCCC1CCCCCC(O)CC(=O)N[C@H]2CSSC[C@H](NC2=O)C(=O)O1 |
| InChI | InChI=1S/C18H30N2O5S2/c1-2-6-13-8-5-3-4-7-12(21)9-16(22)19-14-10-26-27-11-15(18(24)25-13)20-17(14)23/h12-15,21H,2-11H2,1H3,(H,19,22)(H,20,23)/t12?,13?,14-,15-/m0/s1 |
| InChIKey | MVEXFNFRQDFJIE-WUCCLRPBSA-N |
| XLogP | 1.78 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|