C20H30N4O6S2 — CID 59887733
(17E)-4,7,22-trimethyl-2-oxa-12,13-dithia-5,8,21,24-tetrazabicyclo[8.8.6]tetracos-17-ene-3,6,9,20,23-pentone (PubChem CID 59887733) has the molecular formula C20H30N4O6S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (17E)-4,7,22-trimethyl-2-oxa-12,13-dithia-5,8,21,24-tetrazabicyclo[8.8.6]tetracos-17-ene-3,6,9,20,23-pentone.
| Compound Name | (17E)-4,7,22-trimethyl-2-oxa-12,13-dithia-5,8,21,24-tetrazabicyclo[8.8.6]tetracos-17-ene-3,6,9,20,23-pentone |
|---|---|
| PubChem CID | 59887733 |
| Molecular Formula | C20H30N4O6S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (17E)-4,7,22-trimethyl-2-oxa-12,13-dithia-5,8,21,24-tetrazabicyclo[8.8.6]tetracos-17-ene-3,6,9,20,23-pentone |
| SMILES | CC1NC(=O)CC2/C=C/CCCSSCC(NC1=O)C(=O)NC(C)C(=O)NC(C)C(=O)O2 |
| InChI | InChI=1S/C20H30N4O6S2/c1-11-18(27)24-15-10-32-31-8-6-4-5-7-14(9-16(25)21-11)30-20(29)13(3)23-17(26)12(2)22-19(15)28/h5,7,11-15H,4,6,8-10H2,1-3H3,(H,21,25)(H,22,28)(H,23,26)(H,24,27)/b7-5+ |
| InChIKey | IESHZKWWSGUQOC-FNORWQNLSA-N |
| XLogP | 0.03 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|