C13H16F4N2O3S — CID 178007537
2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite (PubChem CID 178007537) has the molecular formula C13H16F4N2O3S and a molecular weight of 356.34 g/mol. Its IUPAC name is 2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite.
| Compound Name | 2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite |
|---|---|
| PubChem CID | 178007537 |
| Molecular Formula | C13H16F4N2O3S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxole;[4-(trifluoromethyl)pyrimidin-2-yl] hypofluorite |
| SMILES | CC1(C)OC2CCSCC2O1.FOc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H14O2S.C5H2F4N2O/c1-8(2)9-6-3-4-11-5-7(6)10-8;6-5(7,8)3-1-2-10-4(11-3)12-9/h6-7H,3-5H2,1-2H3;1-2H |
| InChIKey | MUITUOSYFADOFA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |