C14H18F3N3O4S — CID 171558782
N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfinyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171558782) has the molecular formula C14H18F3N3O4S and a molecular weight of 381.38 g/mol. Its IUPAC name is N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfinyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfinyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171558782 |
| Molecular Formula | C14H18F3N3O4S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfinyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CS(=O)[C@H]1OC[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H18F3N3O4S/c1-13(2)23-7-6-22-11(25(3)21)9(10(7)24-13)20-12-18-5-4-8(19-12)14(15,16)17/h4-5,7,9-11H,6H2,1-3H3,(H,18,19,20)/t7-,9+,10-,11+,25?/m0/s1 |
| InChIKey | MTJCLZNZRDKOBE-MYOOWFIOSA-N |
| XLogP | 1.53 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |