C16H18F3N3O7 — CID 171558532
[(3S,4R,5R,6R)-4,6-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-3-yl] acetate (PubChem CID 171558532) has the molecular formula C16H18F3N3O7 and a molecular weight of 421.33 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,6-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-3-yl] acetate.
| Compound Name | [(3S,4R,5R,6R)-4,6-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 171558532 |
| Molecular Formula | C16H18F3N3O7 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(3S,4R,5R,6R)-4,6-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F3N3O7/c1-7(23)27-10-6-26-14(29-9(3)25)12(13(10)28-8(2)24)22-15-20-5-4-11(21-15)16(17,18)19/h4-5,10,12-14H,6H2,1-3H3,(H,20,21,22)/t10-,12+,13-,14+/m0/s1 |
| InChIKey | DDWJWXFWBRKJFZ-AHLTXXRQSA-N |
| XLogP | 1.06 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|