C19H15B2ClN6O6 — CID 178009175
CID 178009175 (PubChem CID 178009175) has the molecular formula C19H15B2ClN6O6 and a molecular weight of 480.44 g/mol.
| Compound Name | CID 178009175 |
|---|---|
| PubChem CID | 178009175 |
| Molecular Formula | C19H15B2ClN6O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)n1cnc(COc2c(OC(O)(O)O)cc(-c3cccc(Cl)c3)c3ncnc(N)c23)n1 |
| InChI | InChI=1S/C19H15B2ClN6O6/c20-18(21,29)28-8-26-13(27-28)6-33-16-12(34-19(30,31)32)5-11(9-2-1-3-10(22)4-9)15-14(16)17(23)25-7-24-15/h1-5,7-8,29-32H,6H2,(H2,23,24,25) |
| InChIKey | QIBICMCELNXLMQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 181.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|