C19H12Cl2FN5O — CID 178009676
8-(2,3-dichlorophenyl)-7-fluoro-5-(pyrimidin-2-ylmethoxy)quinazolin-4-amine (PubChem CID 178009676) has the molecular formula C19H12Cl2FN5O and a molecular weight of 416.24 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)-7-fluoro-5-(pyrimidin-2-ylmethoxy)quinazolin-4-amine.
| Compound Name | 8-(2,3-dichlorophenyl)-7-fluoro-5-(pyrimidin-2-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 178009676 |
| Molecular Formula | C19H12Cl2FN5O |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 8-(2,3-dichlorophenyl)-7-fluoro-5-(pyrimidin-2-ylmethoxy)quinazolin-4-amine |
| SMILES | Nc1ncnc2c(-c3cccc(Cl)c3Cl)c(F)cc(OCc3ncccn3)c12 |
| InChI | InChI=1S/C19H12Cl2FN5O/c20-11-4-1-3-10(17(11)21)15-12(22)7-13(16-18(15)26-9-27-19(16)23)28-8-14-24-5-2-6-25-14/h1-7,9H,8H2,(H2,23,26,27) |
| InChIKey | MDUBBPLCOIMLRB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |