C21H20ClN5O3 — CID 69172538
5-(3-chlorophenyl)-9-methoxy-8-(2-methoxyethoxy)pyrimido[5,4-c]quinoline-2,4-diamine (PubChem CID 69172538) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-9-methoxy-8-(2-methoxyethoxy)pyrimido[5,4-c]quinoline-2,4-diamine.
| Compound Name | 5-(3-chlorophenyl)-9-methoxy-8-(2-methoxyethoxy)pyrimido[5,4-c]quinoline-2,4-diamine |
|---|---|
| PubChem CID | 69172538 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 5-(3-chlorophenyl)-9-methoxy-8-(2-methoxyethoxy)pyrimido[5,4-c]quinoline-2,4-diamine |
| SMILES | COCCOc1cc2nc(-c3cccc(Cl)c3)c3c(N)nc(N)nc3c2cc1OC |
| InChI | InChI=1S/C21H20ClN5O3/c1-28-6-7-30-16-10-14-13(9-15(16)29-2)19-17(20(23)27-21(24)26-19)18(25-14)11-4-3-5-12(22)8-11/h3-5,8-10H,6-7H2,1-2H3,(H4,23,24,26,27) |
| InChIKey | JCZHBZAJSLSSLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|