C10H21NO2 — CID 178009984
N-[(E)-but-2-enyl]-2-ethoxyacetamide;ethane (PubChem CID 178009984) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-ethoxyacetamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-2-ethoxyacetamide;ethane |
|---|---|
| PubChem CID | 178009984 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-ethoxyacetamide;ethane |
| SMILES | C/C=C/CNC(=O)COCC.CC |
| InChI | InChI=1S/C8H15NO2.C2H6/c1-3-5-6-9-8(10)7-11-4-2;1-2/h3,5H,4,6-7H2,1-2H3,(H,9,10);1-2H3/b5-3+; |
| InChIKey | HJSXMVBFPKJRQE-WGCWOXMQSA-N |
| XLogP | 1.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|