C20H41N3O — CID 178010853
2-amino-N-[(E)-but-2-enyl]propanamide;ethane;N-ethyl-2-propylcyclohexen-1-amine (PubChem CID 178010853) has the molecular formula C20H41N3O and a molecular weight of 339.57 g/mol. Its IUPAC name is 2-amino-N-[(E)-but-2-enyl]propanamide;ethane;N-ethyl-2-propylcyclohexen-1-amine.
| Compound Name | 2-amino-N-[(E)-but-2-enyl]propanamide;ethane;N-ethyl-2-propylcyclohexen-1-amine |
|---|---|
| PubChem CID | 178010853 |
| Molecular Formula | C20H41N3O |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.32 |
| IUPAC Name | 2-amino-N-[(E)-but-2-enyl]propanamide;ethane;N-ethyl-2-propylcyclohexen-1-amine |
| SMILES | C/C=C/CNC(=O)C(C)N.CC.CCCC1=C(NCC)CCCC1 |
| InChI | InChI=1S/C11H21N.C7H14N2O.C2H6/c1-3-7-10-8-5-6-9-11(10)12-4-2;1-3-4-5-9-7(10)6(2)8;1-2/h12H,3-9H2,1-2H3;3-4,6H,5,8H2,1-2H3,(H,9,10);1-2H3/b;4-3+; |
| InChIKey | OVXHEBDBMBYJFL-ITDJAWRYSA-N |
| XLogP | 4.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|