C10H19N3O — CID 178011215
N-[(E)-but-2-enyl]-2-imidazolidin-1-ylpropanamide (PubChem CID 178011215) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-imidazolidin-1-ylpropanamide.
| Compound Name | N-[(E)-but-2-enyl]-2-imidazolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 178011215 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-imidazolidin-1-ylpropanamide |
| SMILES | C/C=C/CNC(=O)C(C)N1CCNC1 |
| InChI | InChI=1S/C10H19N3O/c1-3-4-5-12-10(14)9(2)13-7-6-11-8-13/h3-4,9,11H,5-8H2,1-2H3,(H,12,14)/b4-3+ |
| InChIKey | CAJFCAZFVFVYEQ-ONEGZZNKSA-N |
| XLogP | -0.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|