C19H17N3O2 — CID 178012653
(2-cyclopropylimidazo[1,2-a]pyrimidin-3-yl)-(4-prop-2-enoxyphenyl)methanone (PubChem CID 178012653) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2-cyclopropylimidazo[1,2-a]pyrimidin-3-yl)-(4-prop-2-enoxyphenyl)methanone.
| Compound Name | (2-cyclopropylimidazo[1,2-a]pyrimidin-3-yl)-(4-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 178012653 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2-cyclopropylimidazo[1,2-a]pyrimidin-3-yl)-(4-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccc(C(=O)c2c(C3CC3)nc3ncccn23)cc1 |
| InChI | InChI=1S/C19H17N3O2/c1-2-12-24-15-8-6-14(7-9-15)18(23)17-16(13-4-5-13)21-19-20-10-3-11-22(17)19/h2-3,6-11,13H,1,4-5,12H2 |
| InChIKey | SELWWXDMRZWIFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|