C14H13F3N2OS2 — CID 178016569
1-(4-methyl-5-methylsulfanylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 178016569) has the molecular formula C14H13F3N2OS2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-(4-methyl-5-methylsulfanylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-methyl-5-methylsulfanylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 178016569 |
| Molecular Formula | C14H13F3N2OS2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-(4-methyl-5-methylsulfanylthiophen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CSc1sc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C14H13F3N2OS2/c1-8-6-11(22-12(8)21-2)19-13(20)18-10-5-3-4-9(7-10)14(15,16)17/h3-7H,1-2H3,(H2,18,19,20) |
| InChIKey | JOPXJCGPZWKTLY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |