C15H14F3N3OS2 — CID 123395797
1-[4-(methyliminomethyl)-5-methylsulfanylthiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 123395797) has the molecular formula C15H14F3N3OS2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[4-(methyliminomethyl)-5-methylsulfanylthiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(methyliminomethyl)-5-methylsulfanylthiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 123395797 |
| Molecular Formula | C15H14F3N3OS2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[4-(methyliminomethyl)-5-methylsulfanylthiophen-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C/N=C/c1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)sc1SC |
| InChI | InChI=1S/C15H14F3N3OS2/c1-19-8-9-6-12(24-13(9)23-2)21-14(22)20-11-5-3-4-10(7-11)15(16,17)18/h3-8H,1-2H3,(H2,20,21,22)/b19-8+ |
| InChIKey | ZRBRXEPTKZEXKM-UFWORHAWSA-N |
| XLogP | 5.18 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|