C23H24ClN5O3S — CID 178022783
2-[7-[3-[(2-chloroacetyl)amino]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid (PubChem CID 178022783) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 2-[7-[3-[(2-chloroacetyl)amino]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid.
| Compound Name | 2-[7-[3-[(2-chloroacetyl)amino]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
|---|---|
| PubChem CID | 178022783 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-[7-[3-[(2-chloroacetyl)amino]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1N=C(c2cccc(NC(=O)CCl)c2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C23H24ClN5O3S/c1-5-16(23(31)32)20-21-28-27-13(4)29(21)22-18(11(2)12(3)33-22)19(26-20)14-7-6-8-15(9-14)25-17(30)10-24/h6-9,16,20H,5,10H2,1-4H3,(H,25,30)(H,31,32) |
| InChIKey | JFZKRYLCOSPZAN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|