C26H23N7O2S — CID 67446240
2-[(9S)-7-[4-(6-cyanopyrazin-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid (PubChem CID 67446240) has the molecular formula C26H23N7O2S and a molecular weight of 497.58 g/mol. Its IUPAC name is 2-[(9S)-7-[4-(6-cyanopyrazin-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid.
| Compound Name | 2-[(9S)-7-[4-(6-cyanopyrazin-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67446240 |
| Molecular Formula | C26H23N7O2S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[(9S)-7-[4-(6-cyanopyrazin-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)[C@@H]1N=C(c2ccc(-c3cncc(C#N)n3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C26H23N7O2S/c1-5-19(26(34)35)23-24-32-31-15(4)33(24)25-21(13(2)14(3)36-25)22(30-23)17-8-6-16(7-9-17)20-12-28-11-18(10-27)29-20/h6-9,11-12,19,23H,5H2,1-4H3,(H,34,35)/t19?,23-/m0/s1 |
| InChIKey | WVWNIOYGDWGNQR-BVHINDKJSA-N |
| XLogP | 4.59 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |