C26H31BN4O4S — CID 67446632
2-[(9S)-7-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid (PubChem CID 67446632) has the molecular formula C26H31BN4O4S and a molecular weight of 506.44 g/mol. Its IUPAC name is 2-[(9S)-7-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid.
| Compound Name | 2-[(9S)-7-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67446632 |
| Molecular Formula | C26H31BN4O4S |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[(9S)-7-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
| SMILES | CCC(C(=O)O)[C@@H]1N=C(c2ccc(B3OCC(C)(C)CO3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C26H31BN4O4S/c1-7-19(25(32)33)22-23-30-29-16(4)31(23)24-20(14(2)15(3)36-24)21(28-22)17-8-10-18(11-9-17)27-34-12-26(5,6)13-35-27/h8-11,19,22H,7,12-13H2,1-6H3,(H,32,33)/t19?,22-/m0/s1 |
| InChIKey | QJHWEABLAZIQNH-BPARTEKVSA-N |
| XLogP | 4.03 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|