C29H33N7O2S — CID 67443057
2-[(9S)-7-[4-[6-(butylamino)pyrimidin-4-yl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid (PubChem CID 67443057) has the molecular formula C29H33N7O2S and a molecular weight of 543.70 g/mol. Its IUPAC name is 2-[(9S)-7-[4-[6-(butylamino)pyrimidin-4-yl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid.
| Compound Name | 2-[(9S)-7-[4-[6-(butylamino)pyrimidin-4-yl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
|---|---|
| PubChem CID | 67443057 |
| Molecular Formula | C29H33N7O2S |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 2-[(9S)-7-[4-[6-(butylamino)pyrimidin-4-yl]phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]butanoic acid |
| SMILES | CCCCNc1cc(-c2ccc(C3=N[C@@H](C(CC)C(=O)O)c4nnc(C)n4-c4sc(C)c(C)c43)cc2)ncn1 |
| InChI | InChI=1S/C29H33N7O2S/c1-6-8-13-30-23-14-22(31-15-32-23)19-9-11-20(12-10-19)25-24-16(3)17(4)39-28(24)36-18(5)34-35-27(36)26(33-25)21(7-2)29(37)38/h9-12,14-15,21,26H,6-8,13H2,1-5H3,(H,37,38)(H,30,31,32)/t21?,26-/m0/s1 |
| InChIKey | VUINQFSADQXVCP-UQTORGHUSA-N |
| XLogP | 5.93 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|