C33H41NNiO-2 — CID 178022784
carbanide;[(4E,6E,8Z)-8-[3,3-dimethyl-1-(6-oxoheptyl)indol-2-ylidene]-2-methyl-2-phenylocta-4,6-dien-3-ylidene]nickel (PubChem CID 178022784) has the molecular formula C33H41NNiO-2 and a molecular weight of 526.39 g/mol. Its IUPAC name is carbanide;[(4E,6E,8Z)-8-[3,3-dimethyl-1-(6-oxoheptyl)indol-2-ylidene]-2-methyl-2-phenylocta-4,6-dien-3-ylidene]nickel.
| Compound Name | carbanide;[(4E,6E,8Z)-8-[3,3-dimethyl-1-(6-oxoheptyl)indol-2-ylidene]-2-methyl-2-phenylocta-4,6-dien-3-ylidene]nickel |
|---|---|
| PubChem CID | 178022784 |
| Molecular Formula | C33H41NNiO-2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | carbanide;[(4E,6E,8Z)-8-[3,3-dimethyl-1-(6-oxoheptyl)indol-2-ylidene]-2-methyl-2-phenylocta-4,6-dien-3-ylidene]nickel |
| SMILES | CC(=O)CCCCCN1/C(=C\C=C\C=C\C(=[Ni])C(C)(C)c2[c-]cccc2)C(C)(C)c2ccccc21.[CH3-] |
| InChI | InChI=1S/C32H38NO.CH3.Ni/c1-26(34)18-10-9-17-25-33-29-22-15-14-21-28(29)32(4,5)30(33)23-13-6-7-16-24-31(2,3)27-19-11-8-12-20-27;;/h6-8,11-16,19,21-23H,9-10,17-18,25H2,1-5H3;1H3;/q2*-1;/b13-6+,16-7+,30-23-;; |
| InChIKey | UNLQRZWZFJCMQR-JVODZZOISA-N |
| XLogP | 7.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|