C20H16N6O — CID 178023481
N-[4-(1-aminoisoquinolin-4-yl)but-3-ynyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide (PubChem CID 178023481) has the molecular formula C20H16N6O and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[4-(1-aminoisoquinolin-4-yl)but-3-ynyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide.
| Compound Name | N-[4-(1-aminoisoquinolin-4-yl)but-3-ynyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 178023481 |
| Molecular Formula | C20H16N6O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[4-(1-aminoisoquinolin-4-yl)but-3-ynyl]-1H-imidazo[4,5-b]pyridine-2-carboxamide |
| SMILES | Nc1ncc(C#CCCNC(=O)c2nc3ncccc3[nH]2)c2ccccc12 |
| InChI | InChI=1S/C20H16N6O/c21-17-15-8-2-1-7-14(15)13(12-24-17)6-3-4-10-23-20(27)19-25-16-9-5-11-22-18(16)26-19/h1-2,5,7-9,11-12H,4,10H2,(H2,21,24)(H,23,27)(H,22,25,26) |
| InChIKey | BNBRBYIGDPRQPS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|